CymitQuimica logo

CAS 96850-30-5

:

Kaur-16-ene-1,7-dione,15-(acetyloxy)-3,20-epoxy-6-hydroxy-, (3a,6b,15b)-

Description:
Kaur-16-ene-1,7-dione,15-(acetyloxy)-3,20-epoxy-6-hydroxy-, also known by its CAS number 96850-30-5, is a naturally occurring compound classified as a diterpenoid. This substance is characterized by its complex molecular structure, which includes multiple functional groups such as ketones, acetoxy, and hydroxyl groups, contributing to its reactivity and potential biological activity. The presence of an epoxy group indicates that it may participate in various chemical reactions, including nucleophilic attacks. Kaur-16-ene derivatives are often studied for their pharmacological properties, including anti-inflammatory and anticancer activities. The stereochemistry of this compound, denoted by the specific configuration at various chiral centers, plays a crucial role in its biological interactions and efficacy. Additionally, its solubility and stability can be influenced by the presence of the acetoxy and hydroxyl groups, making it a subject of interest in both synthetic and natural product chemistry. Overall, Kaur-16-ene-1,7-dione represents a significant compound within the realm of natural products with potential therapeutic applications.
Formula:C22H28O6
InChI:InChI=1S/C22H28O6/c1-10-12-5-6-13-21(8-12,19(10)28-11(2)23)18(26)16(25)17-20(3,4)15-7-14(24)22(13,17)9-27-15/h12-13,15-17,19,25H,1,5-9H2,2-4H3/t12-,13-,15-,16+,17-,19-,21-,22-/m1/s1
InChI key:DCULYKVTBAXAER-XETVFITMSA-N
SMILES:CC(=O)O[C@@H]1C(=C)[C@@H]2CC[C@@H]3[C@]1(C2)C(=O)[C@H]([C@H]4[C@]35CO[C@@H](C4(C)C)CC5=O)O
Synonyms:
  • MaoecrystalA
  • maoecrystal A
Found 6 products.