CymitQuimica logo

CAS 96860-19-4

:

N1-(2-furylmethyl)hydrazine-1-carbothioamide

Description:
N1-(2-furylmethyl)hydrazine-1-carbothioamide is a chemical compound characterized by its unique structure, which includes a hydrazine moiety and a furylmethyl group. This compound features a thioamide functional group, which is known for its reactivity and ability to form various derivatives. The presence of the furan ring contributes to its aromatic properties, potentially influencing its solubility and reactivity in organic solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the thioamide group can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, N1-(2-furylmethyl)hydrazine-1-carbothioamide represents a versatile compound with potential applications in both synthetic chemistry and biological research.
Formula:C6H9N3OS
InChI:InChI=1/C6H9N3OS/c7-9-6(11)8-4-5-2-1-3-10-5/h1-3H,4,7H2,(H2,8,9,11)
SMILES:c1cc(CN=C(NN)S)oc1
Synonyms:
  • 4-(2-Furfuryl)-3-thiosemicyrbazide
  • N-(furan-2-ylmethyl)hydrazinecarbothioamide
Found 3 products.