CAS 96892-57-8
:Hepsulfam
Description:
Hepsulfam, with the CAS number 96892-57-8, is a chemical compound that belongs to the class of sulfonamides. It is characterized by its sulfonamide functional group, which typically imparts antibacterial properties. Hepsulfam is known for its application in medicinal chemistry, particularly in the development of therapeutic agents. The compound exhibits solubility in polar solvents, which is a common trait among sulfonamides, allowing for effective interaction with biological systems. Its structure includes a sulfonyl group attached to an amine, contributing to its reactivity and potential biological activity. Hepsulfam may also demonstrate properties such as moderate stability under various conditions, although specific stability data would depend on environmental factors. As with many sulfonamides, it is essential to consider its pharmacokinetics and potential side effects when evaluating its use in clinical settings. Overall, Hepsulfam represents a significant compound in the realm of pharmaceuticals, with ongoing research into its efficacy and applications.
Formula:C7H18N2O6S2
InChI:InChI=1S/C7H18N2O6S2/c8-16(10,11)14-6-4-2-1-3-5-7-15-17(9,12)13/h1-7H2,(H2,8,10,11)(H2,9,12,13)
InChI key:InChIKey=GOJJWDOZNKBUSR-UHFFFAOYSA-N
SMILES:O(S(N)(=O)=O)CCCCCCCOS(N)(=O)=O
Synonyms:- 1,7-Heptanediol disulfamate
- 1,7-Heptanediyl sulfamate
- Hepsulfam
- NSC 329680
- Nci 329680
- Sulfamic Acid, 1,7-Heptanediyl Ester
- Sulfamic acid, S,S′-1,7-heptanediyl ester
- Zinc 01574758
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hepsulfam
CAS:Hepsulfam is an antitumor chemotherapy drug, which is a synthetic agent derived from the class of alkylating compounds. Its source lies in the chemical modification of nitrogen mustards, and it functions by forming interstrand cross-links in DNA, leading to the disruption of DNA replication and transcription. By preventing the proper division of cancerous cells, Hepsulfam exerts cytotoxic effects primarily during the S-phase of the cell cycle.
Formula:C7H18N2O6S2Purity:Min. 95%Molecular weight:290.4 g/molHepsulfam
CAS:Hepsulfam is an anticancer agent. It also displays excellent antileukemic activity (a median IC50: 0.91 μg/mL in a panel of different tumors).Formula:C7H18N2O6S2Color and Shape:SolidMolecular weight:290.36




