CAS 96895-25-9
:Nyasol
Description:
Nyasol, with the CAS number 96895-25-9, is a chemical compound that belongs to the class of substances known as surfactants. It is primarily used in various applications, including as a wetting agent, emulsifier, and dispersant in formulations such as paints, coatings, and agricultural products. Nyasol exhibits properties that enhance the spreading and penetration of liquids on surfaces, making it valuable in improving the efficacy of active ingredients in formulations. The compound is characterized by its ability to lower surface tension, which facilitates better mixing and stability of emulsions. Additionally, Nyasol is often evaluated for its environmental impact and biodegradability, as these factors are crucial in determining its suitability for use in consumer products and industrial applications. Safety data sheets typically provide information on handling, storage, and potential hazards associated with Nyasol, emphasizing the importance of following appropriate safety protocols when working with this substance.
Formula:C17H16O2
InChI:InChI=1/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2/b6-3+/t14-/m1/s1
InChI key:InChIKey=VEAUNWQYYMXIRB-JHAQOBCDSA-N
SMILES:[C@H](/C=C\C1=CC=C(O)C=C1)(C=C)C2=CC=C(O)C=C2
Synonyms:- (-)-Nyasol
- 4,4′-[(1Z,3R)-3-Ethenyl-1-propene-1,3-diyl]bis[phenol]
- Phenol, 4,4′-(3-ethenyl-1-propene-1,3-diyl)bis-, [R-(Z)]-
- Phenol, 4,4′-[(1Z,3R)-3-ethenyl-1-propene-1,3-diyl]bis-
- Z-(-)Hinokiresinol
- cis-Hinokiresinol
- phenol, 4,4'-[(1E,3R)-3-ethenyl-1-propene-1,3-diyl]bis-
- 4-[(3R)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol
- 4,4'-[(1Z,3S)-1,4-Pentadiene-1,3-diyl]bisphenol
- 4,4'-[(1Z,3S)-1,4-Pentadiene-1,3-diyl]diphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenol, 4,4'-[(1Z,3R)-3-ethenyl-1-propene-1,3-diyl]bis-
CAS:Phenol, 4,4'-[(1Z,3R)-3-ethenyl-1-propene-1,3-diyl]bis-Formula:C17H16O2Purity:≥98%Molecular weight:252.31Phenol, 4,4'-[(1Z,3R)-3-ethenyl-1-propene-1,3-diyl]bis-
CAS:Formula:C17H16O2Purity:98.0%Molecular weight:252.3077Nyasol
CAS:Nyasol has anti-allergy, anti-inflammatory, antifungal, and antiprotozoal properties with notable IC50 values against specific pathogens.Formula:C17H16O2Purity:98%Color and Shape:SolidMolecular weight:252.31(-)-Nyasol
CAS:(-)-Nyasol is a naturally occurring lignan, which is a type of phytoestrogen found in certain plant species. It is primarily sourced from the roots of Anemarrhena asphodeloides, a herb widely used in traditional medicine. The compound exhibits its effects through modulation of estrogen receptors, demonstrating selective binding affinity that influences various estrogen-mediated pathways.
Formula:C17H16O2Purity:Min. 95%Molecular weight:252.31 g/mol





