CymitQuimica logo

CAS 96905-68-9

:

Ethyl 2,5-dioxo-3-pyrrolidinecarboxylate

Description:
Ethyl 2,5-dioxo-3-pyrrolidinecarboxylate, with the CAS number 96905-68-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features two carbonyl groups (dioxo) and an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Ethyl 2,5-dioxo-3-pyrrolidinecarboxylate is typically a white to off-white solid, and its molecular structure allows for potential interactions in biological systems, which may lead to pharmacological activities. The compound is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C7H9NO4
InChI:InChI=1S/C7H9NO4/c1-2-12-7(11)4-3-5(9)8-6(4)10/h4H,2-3H2,1H3,(H,8,9,10)
InChI key:InChIKey=STXJWMUXKCYVJA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C(=O)NC(=O)C1
Synonyms:
  • 2,5-Dioxo-pyrrolidine-3-carboxylic acid ethyl ester
  • 3-Ethoxycarbonylsuccinimide
  • 3-Pyrrolidinecarboxylic Acid, 2,5-Dioxo-, Ethyl Ester
  • Ethyl 2,5-dioxo-3-pyrrolidinecarboxylate
Found 1 products.