CymitQuimica logo

CAS 96905-69-0

:

2,5-dioxopyrrolidine-3-carboxylic acid

Description:
2,5-Dioxopyrrolidine-3-carboxylic acid, also known by its CAS number 96905-69-0, is a cyclic compound characterized by a five-membered ring structure containing two carbonyl groups (dioxo) and a carboxylic acid functional group. This compound is part of the pyrrolidine family, which is known for its nitrogen-containing heterocycles. The presence of the two carbonyl groups contributes to its reactivity, making it a potential intermediate in organic synthesis. The carboxylic acid group imparts acidic properties, allowing for potential interactions in various chemical reactions, such as esterification or amidation. Additionally, the compound may exhibit solubility in polar solvents due to the presence of the carboxylic acid, which can engage in hydrogen bonding. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry. Overall, 2,5-dioxopyrrolidine-3-carboxylic acid is a versatile compound with potential applications in both synthetic and pharmaceutical chemistry.
Formula:C5H5NO4
InChI:InChI=1/C5H5NO4/c7-3-1-2(5(9)10)4(8)6-3/h2H,1H2,(H,9,10)(H,6,7,8)
InChI key:AZPXZTOCIRKBSJ-UHFFFAOYSA-N
SMILES:C1C(C(=O)N=C1O)C(=O)O
Synonyms:
  • 3-Pyrrolidinecarboxylic Acid, 2,5-Dioxo-
  • 2,5-Dioxopyrrolidine-3-carboxylic acid
Found 3 products.