CymitQuimica logo

CAS 96938-51-1

:

Benzamide, N-[[(6-methyl-2-pyridinyl)amino]thioxomethyl]-

Description:
Benzamide, N-[[(6-methyl-2-pyridinyl)amino]thioxomethyl]- is a chemical compound characterized by its unique structure, which includes a benzamide moiety and a thioxomethyl group attached to a 6-methyl-2-pyridinyl amino group. This compound typically exhibits properties associated with both amides and thioamides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the thioxomethyl group. The pyridine ring contributes to its aromatic character and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the thio group can enhance its reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Overall, its structural features suggest potential utility in drug development and other chemical applications, although specific biological activities and reactivity would require further investigation through experimental studies.
Formula:C14H13N3OS
InChI:InChI=1S/C14H13N3OS/c1-10-6-5-9-12(15-10)16-14(19)17-13(18)11-7-3-2-4-8-11/h2-9H,1H3,(H2,15,16,17,18,19)
InChI key:VWKPOGQHIDVZER-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1)NC(=S)NC(=O)C2=CC=CC=C2
Found 4 products.