CymitQuimica logo

CAS 96980-64-2

:

3-Chloro-N-(chloroacetyl)-4-fluoroaniline

Description:
3-Chloro-N-(chloroacetyl)-4-fluoroaniline, with the CAS number 96980-64-2, is an organic compound characterized by its aromatic amine structure. It features a chloro group and a fluoro group attached to a benzene ring, which contributes to its reactivity and potential applications in various chemical processes. The presence of the chloroacetyl group enhances its electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing effects of the halogen substituents, which can affect its reactivity in nucleophilic substitution reactions. Safety precautions should be observed when handling this compound, as it may pose health risks due to its potential toxicity and reactivity. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C8H6Cl2FNO
InChI:InChI=1/C8H6Cl2FNO/c9-4-8(13)12-5-1-2-7(11)6(10)3-5/h1-3H,4H2,(H,12,13)
InChI key:DJPAQYXQRCWKEH-UHFFFAOYSA-N
SMILES:c1cc(c(cc1N=C(CCl)O)Cl)F
Synonyms:
  • N1-(3-Chloro-4-fluorophenyl)-2-chloroacetamide
  • 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide
Found 3 products.