CAS 96990-18-0
:Momordin Ic
Description:
Momordin Ic is a triterpenoid saponin derived from the fruit of the Momordica charantia, commonly known as bitter melon. This compound is characterized by its complex structure, which includes a steroid-like backbone and sugar moieties, contributing to its biological activity. Momordin Ic exhibits various pharmacological properties, including anti-inflammatory, anti-diabetic, and anti-cancer effects, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves modulation of metabolic pathways and interaction with cellular receptors. Additionally, Momordin Ic has been studied for its potential to influence glucose metabolism, which is particularly relevant in the context of diabetes management. The compound's solubility and stability can vary depending on the formulation and conditions, which is crucial for its therapeutic applications. Overall, Momordin Ic represents a promising natural product with significant potential in health and disease management, warranting further research to fully elucidate its mechanisms and therapeutic benefits.
Formula:C41H64O13
InChI:InChI=1/C41H64O13/c1-36(2)14-16-41(35(49)50)17-15-39(6)20(21(41)18-36)8-9-24-38(5)12-11-25(37(3,4)23(38)10-13-40(24,39)7)52-34-29(46)30(28(45)31(54-34)32(47)48)53-33-27(44)26(43)22(42)19-51-33/h8,21-31,33-34,42-46H,9-19H2,1-7H3,(H,47,48)(H,49,50)/t21-,22+,23-,24+,25-,26-,27+,28-,29+,30-,31-,33-,34+,38-,39+,40+,41-/m0/s1
InChI key:HWYBGIDROCYPOE-WEAQAMGWSA-N
SMILES:C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O
Synonyms:- (3beta)-28-Hydroxy-28-oxoolean-12-en-3-yl 3-O-beta-D-xylopyranosyl-beta-D-glucopyranosiduronic acid
- olean-12-en-28-oic acid, 3-[(3-O-beta-D-xylopyranosyl-beta-D-glucopyranuronosyl)oxy]-, (3beta)-
- Momordinic
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 14 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Momordin Ic (Standard)
CAS:Momordin Ic (Standard) is a reference standard for research and analysis in studies involving Momordin Ic. Momordin Ic (Momordin 1c) might represent a potential anticancer activity, by inducing apoptosis through oxidative stress-regulated mitochondrial dysfunction involving the MAPK and PI3K-mediated iNOS and HO-1 pathways. Also, Momordin Ic accelerates gastrointestinal transit partially by stimulating synthesis of 5-HT to act through 5-HT(2), which, in turn, increases synthesis of prostaglandins.Formula:C41H64O13Molecular weight:764.9391Momordin Ic
CAS:Momordin Ic (Momordin 1c) might represent a potential anticancer activity, by inducing apoptosis through oxidative stress-regulated mitochondrial dysfunctionFormula:C41H64O13Purity:98% - 99.69%Color and Shape:SolidMolecular weight:764.9391Momordin Ic
CAS:Natural glycosideFormula:C41H64O13Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:764.95Momordin Ic
CAS:(2S,3S,4S,5R,6R)-6-(((3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-Carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl)oxy)-3,5-dihydroxy-4-(((2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-carboxylic acidFormula:C41H64O13Purity:95%Molecular weight:764.94Momordin Ic
CAS:Controlled ProductStability Hygroscopic
Applications Mormodin Ic is used as an anti-cancer agent, and is shown to induce HepG2 apoptosis in a PI3K and MAPK pathway-dependant manner.
References Wang, J. et al.: Food Func., 5, 859 (2014);Formula:C41H64O13Color and Shape:NeatMolecular weight:764.94Momordin 1c
CAS:Momordin 1c is a triterpenoid saponin, a type of secondary metabolite, extracted primarily from species of the plant genus *Momordica*, such as *Momordica charantia*—commonly known as bitter melon. This compound is characterized by its unique structure, which contributes to its biological activities.
Formula:C41H64O13Purity:Min. 95%Color and Shape:PowderMolecular weight:764.94 g/mol
