CAS 97-20-1
:3-diethylaminobenzoic acid
Description:
3-Diethylaminobenzoic acid, with the CAS number 97-20-1, is an organic compound that belongs to the class of benzoic acids. It features a benzoic acid structure with a diethylamino group attached to the meta position of the aromatic ring. This compound is typically a white to off-white crystalline solid, and it is known for its solubility in organic solvents while being less soluble in water. The presence of the diethylamino group imparts basic properties, allowing it to act as a weak base. 3-Diethylaminobenzoic acid is often utilized in various chemical applications, including as an intermediate in the synthesis of dyes and pharmaceuticals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its melting point and boiling point can vary based on purity and specific conditions, and it should be handled with care due to potential toxicity associated with amine compounds. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C11H15NO2
InChI:InChI=1/C11H15NO2/c1-3-12(4-2)10-7-5-6-9(8-10)11(13)14/h5-8H,3-4H2,1-2H3,(H,13,14)
InChI key:InChIKey=TYXZQVMCGZKDEK-UHFFFAOYSA-N
SMILES:CCN(CC)c1cccc(c1)C(=O)O
Synonyms:- 3-(Diethylamino)Benzenesulfonic Acid
- 3-Diethylaminobenzenesulfonic acid
- Benzenesulfonic acid, 3-(diethylamino)-
- Diethylaniline-m-sulfonic acid
- Diethylmetanilic acid
- Metanilic acid, N,N-diethyl-
- N,N-Diethyl-3-sulfoaniline
- N,N-diethylmetanilic acid
- NSC 8634
- m-(Diethylamino)benzenesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Diethylamino)benzenesulfonic acid
CAS:3-(Diethylamino)benzenesulfonic acidFormula:C10H15NO3SPurity:95%Molecular weight:229.33-(Diethylamino)benzenesulfonic acid
CAS:Formula:C10H15NO3SPurity:95%Color and Shape:SolidMolecular weight:229.29603-Diethylaminobenzenesulfonic acid
CAS:3-Diethylaminobenzenesulfonic acid is a reactive molecule that reacts with sodium carbonate to form sodium sulfonate and diethylamine. 3-Diethylaminobenzenesulfonic acid also reacts with naphthalene to form the nitro derivative. This compound is soluble in hydrochloric acid and sodium hydroxide solution, but insoluble in water. It has been used as an intermediate for the synthesis of potassium dichromate, sodium chloride, and other inorganic acids.Formula:C10H15NO3SPurity:Min. 95%Molecular weight:229.3 g/mol




