CAS 97075-46-2
:1,2-Ethanediamine, N,N′-bis(diphenylmethyl)-, hydrochloride (1:2)
Description:
1,2-Ethanediamine, N,N′-bis(diphenylmethyl)-, hydrochloride (1:2), with CAS number 97075-46-2, is a chemical compound characterized by its amine functional groups and the presence of diphenylmethyl substituents. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of two amine groups allows for potential interactions with various biological systems, making it of interest in medicinal chemistry and organic synthesis. Its structure suggests that it may exhibit properties such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Additionally, the diphenylmethyl groups may provide steric hindrance, affecting the compound's reactivity and stability. As with many amines, safety precautions should be taken when handling this substance, as it may be irritating to the skin and eyes.
Formula:C28H28N2·2ClH
InChI:InChI=1S/C28H28N2.2ClH/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;/h1-20,27-30H,21-22H2;2*1H
InChI key:InChIKey=YRQCDCNQANSUPB-UHFFFAOYSA-N
SMILES:C(NCCNC(C1=CC=CC=C1)C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.Cl
Synonyms:- 1,2-Ethanediamine, N,N′-bis(diphenylmethyl)-, dihydrochloride
- 1,2-Ethanediamine, N,N′-bis(diphenylmethyl)-, hydrochloride (1:2)
- Ethylenediamine, N,N′-bis(diphenylmethyl)-, dihydrochloride
- AMN 082
- N,N′-Dibenzhydrylethylenediamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
AMN082 dihydrochloride
CAS:Formula:C28H30Cl2N2Purity:98%Color and Shape:SolidMolecular weight:465.4572AMN082
CAS:AMN082 is an mGluR7 agonist with antidepressant effects. Neuroprotective effect of AMN082 on neuronal apoptosis in rats with traumatic brain injury.Formula:C28H30Cl2N2Purity:97.13% - 98.63%Color and Shape:SolidMolecular weight:465.46AMN 082 Dihydrochloride
CAS:AMN 082 Dihydrochloride is a chemical compound used primarily as a selective agonist of the metabotropic glutamate receptor 3 (mGluR3). It is synthesized in a laboratory setting, where precise chemical manipulation allows for specificity in receptor targeting. The product functions by modulating the mGluR3 receptor, which is a component of the broader metabotropic glutamate receptor family. These receptors are G-protein coupled and play a critical role in regulating synaptic transmission and plasticity in the central nervous system.Formula:C28H28N2·HClPurity:Min. 95%Molecular weight:392.54 g/mol






