CAS 97151-04-7
:(γE)-γ-[[4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethylene]benzenepropanol
Description:
The chemical substance known as (γE)-γ-[[4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethylene]benzenepropanol, with the CAS number 97151-04-7, is a complex organic compound characterized by its unique molecular structure, which includes a dimethylamino group and an ethoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It may possess hydrophobic characteristics due to the presence of multiple aromatic rings, which can influence its solubility and interaction with biological membranes. The dimethylamino group suggests potential for basicity, which may affect its reactivity and interaction with other molecules. Additionally, the presence of a hydroxyl group indicates potential for hydrogen bonding, which can play a significant role in its pharmacological properties. Overall, this compound's structural features suggest it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C26H29NO2
InChI:InChI=1S/C26H29NO2/c1-27(2)18-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-19-28)21-9-5-3-6-10-21/h3-16,28H,17-20H2,1-2H3/b26-25+
InChI key:InChIKey=XIWBHBPMBIXYBK-OCEACIFDSA-N
SMILES:C(=C(\CCO)/C1=CC=CC=C1)(\C2=CC=C(OCCN(C)C)C=C2)/C3=CC=CC=C3
Synonyms:- (γE)-γ-[[4-[2-(Dimethylamino)ethoxy]phenyl]phenylmethylene]benzenepropanol
- Benzenepropanol, γ-[[4-[2-(dimethylamino)ethoxy]phenyl]phenylmethylene]-, (γE)-
- Benzenepropanol, γ-[[4-[2-(dimethylamino)ethoxy]phenyl]phenylmethylene]-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Toremifene Impurity 4
CAS:Formula:C26H29NO2Color and Shape:White To Off-White SolidMolecular weight:387.52cis-β-Hydroxy Tamoxifen
CAS:Controlled ProductApplications A hydroxylated analogue of Tamoxifen (T006000) with anti-estrogenic properties.
References Ruenitz, P.C. et al.: J. Med. Chem., 25, 1056 (1982)Formula:C26H29NO2Color and Shape:NeatMolecular weight:387.51

