CymitQuimica logo

CAS 97216-16-5

:

L-proline B-naphthylamide hydrochloride

Description:
L-proline B-naphthylamide hydrochloride is a chemical compound characterized by its structure, which includes the amino acid proline linked to a B-naphthylamide moiety. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, making it useful in biochemical applications. It is often employed in peptide synthesis and as a building block in medicinal chemistry due to its ability to mimic peptide bonds and influence protein folding. The hydrochloride form indicates the presence of hydrochloric acid, which enhances its solubility and stability. L-proline itself is a non-essential amino acid that plays a crucial role in collagen synthesis and is involved in various metabolic processes. The presence of the B-naphthylamide group can impart unique properties, such as increased hydrophobicity and potential interactions with biological targets. Overall, L-proline B-naphthylamide hydrochloride is a valuable compound in research and pharmaceutical development, particularly in the study of enzyme inhibitors and drug design.
Formula:C15H16N2O·HCl
InChI:InChI=1S/C15H16N2O.ClH/c18-15(14-6-3-9-16-14)17-13-8-7-11-4-1-2-5-12(11)10-13;/h1-2,4-5,7-8,10,14,16H,3,6,9H2,(H,17,18);1H/t14-;/m0./s1
InChI key:UKXYCTFKKXKIPY-UQKRIMTDSA-N
SMILES:C1C[C@H](NC1)C(=O)NC2=CC3=CC=CC=C3C=C2.Cl
Synonyms:
  • L-Proline Beta-Naphthylamide Hydrochloride
Found 8 products.