CymitQuimica logo

CAS 97230-46-1

:

(2R)-2-[(3R,8S,9R,10R,13R,14S,16R,17R)-3-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-16-hydroxy-4,4,9,13,14-pentamethyl-11-oxo-1,2,3,7,8,10,12,15,16,17-d

Description:
The chemical substance with the name provided is a complex organic molecule characterized by multiple stereocenters and functional groups, indicative of its potential biological activity. It features a series of hydroxyl (-OH) groups, which suggest it may exhibit strong hydrogen bonding capabilities, enhancing its solubility in polar solvents. The presence of multiple methyl groups indicates a degree of hydrophobic character, which could influence its interaction with biological membranes. The structure includes several tetrahydropyran rings, which are common in natural products and can contribute to the molecule's conformational flexibility. Additionally, the presence of an oxo group (C=O) suggests potential reactivity, possibly allowing for further chemical modifications. Given its complexity, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or as a natural product with therapeutic properties. Its specific stereochemistry may also play a crucial role in its biological activity, influencing how it interacts with biological targets.
Formula:C42H64O14
InChI:InChI=1/C42H64O14/c1-18(2)23-14-26(45)42(9,56-23)35-22(44)15-39(6)25-12-10-20-21(41(25,8)27(46)16-40(35,39)7)11-13-28(38(20,4)5)54-37-34(32(50)30(48)24(17-43)53-37)55-36-33(51)31(49)29(47)19(3)52-36/h10,14,18-19,21-22,24-25,28-37,43-44,47-51H,11-13,15-17H2,1-9H3/t19-,21+,22+,24+,25-,28+,29-,30+,31+,32-,33+,34+,35-,36-,37-,39-,40+,41-,42-/m0/s1
InChI key:YRQJYHITIWJZQN-UGBBSPHQSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@@H]3CC[C@@H]4C(=CC[C@@H]5[C@]4(C(=O)C[C@]6([C@]5(C[C@H]([C@@H]6[C@@]7(C(=O)C=C(O7)C(C)C)C)O)C)C)C)C3(C)C)CO)O)O)O)O)O
Found 10 products.