CymitQuimica logo

CAS 97231-91-9

:

Piperidine, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-

Description:
Piperidine, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]- is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a silyl ether functional group, specifically a dimethylsilyl group attached to a tert-butyl moiety, indicates that this compound has unique properties related to its steric and electronic characteristics. The tert-butyl group contributes to the compound's hydrophobic nature, while the dimethylsilyl group enhances its stability and solubility in organic solvents. This compound is likely to exhibit moderate polarity due to the presence of the nitrogen atom in the piperidine ring, which can participate in hydrogen bonding. Additionally, the presence of the silyl ether may influence its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Overall, this compound's structural features suggest potential utility in the development of pharmaceuticals or as an intermediate in chemical synthesis.
Formula:C11H25NOSi
InChI:InChI=1S/C11H25NOSi/c1-11(2,3)14(4,5)13-10-6-8-12-9-7-10/h10,12H,6-9H2,1-5H3
InChI key:GCPNPVFWMHBPNS-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OC1CCNCC1
Found 4 products.