CymitQuimica logo

CAS 97267-60-2

:

7-Bromo-1,5-naphthyridin-4-ol

Description:
7-Bromo-1,5-naphthyridin-4-ol is a heterocyclic organic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a naphthyridine ring system. This compound features a bicyclic structure that consists of a fused pyridine and pyridone ring, contributing to its unique chemical properties. The bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The hydroxyl group can participate in hydrogen bonding, influencing the compound's solubility and interaction with biological targets. Additionally, the presence of the naphthyridine framework often imparts interesting photophysical properties, which can be exploited in fluorescence studies. Overall, 7-Bromo-1,5-naphthyridin-4-ol is of interest in research due to its potential applications in drug development and as a building block in organic synthesis. Its specific reactivity and interactions can vary based on the surrounding chemical environment and the presence of other functional groups.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-5-3-6-8(11-4-5)7(12)1-2-10-6/h1-4H,(H,10,12)
InChI key:InChIKey=XYJDSGQWBGLNRG-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(Br)C=N2)N=CC1
Synonyms:
  • 7-Bromo-4-hydroxy-1,5-naphthyridine
  • 1,5-Naphthyridin-4-ol, 7-bromo-
  • 7-Bromo-1,5-naphthyridin-4-ol
Found 1 products.