CymitQuimica logo

CAS 97278-44-9

:

2-Pyridinecarboxylic acid, 6-(bromomethyl)-, ethyl ester

Description:
2-Pyridinecarboxylic acid, 6-(bromomethyl)-, ethyl ester, also known by its CAS number 97278-44-9, is an organic compound characterized by its pyridine ring structure substituted with a carboxylic acid and an ethyl ester functional group. This compound features a bromomethyl group at the 6-position of the pyridine ring, which can influence its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit moderate polarity due to the presence of both the ester and carboxylic acid functionalities, which can engage in hydrogen bonding. The bromomethyl group can serve as a useful site for further chemical modifications, making it valuable in medicinal chemistry and material science. Additionally, the ethyl ester moiety can enhance the solubility of the compound in organic solvents, facilitating its use in various chemical reactions. Overall, this compound's unique structure and functional groups make it a candidate for further research and application in synthetic organic chemistry.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-2-13-9(12)8-5-3-4-7(6-10)11-8/h3-5H,2,6H2,1H3
InChI key:LEYJOYYSNHBEEE-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC=CC(=N1)CBr
Found 3 products.