CymitQuimica logo

CAS 97308-23-1

:

1-Aziridinecarboxylicacid, 1,1-dimethylethyl ester

Description:
1-Aziridinecarboxylic acid, 1,1-dimethylethyl ester, also known by its CAS number 97308-23-1, is a chemical compound characterized by its aziridine ring structure, which is a three-membered cyclic amine. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, contributing to its stability and reactivity. The presence of the aziridine ring imparts unique properties, such as increased strain and potential for nucleophilic attack, making it useful in various synthetic applications. The tert-butyl ester enhances its lipophilicity, which can influence its solubility and bioavailability in biological systems. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, its reactivity can be harnessed in polymer chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-7(2,3)10-6(9)8-4-5-8/h4-5H2,1-3H3
InChI key:VBYPJHLRWKGNAI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC1
Synonyms:
  • N-(tert-Butoxycarbonyl)aziridine
  • Aziridinecarboxylicacid,1,1-dimethylethylester
Found 4 products.