CAS 97310-93-5
:2-Pyridinecarboxylicacid, 6-(aminocarbonyl)-
Description:
2-Pyridinecarboxylic acid, 6-(aminocarbonyl)-, also known as 6-amino-2-pyridinecarboxylic acid, is an organic compound characterized by its pyridine ring structure substituted with a carboxylic acid group and an aminocarbonyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both the carboxylic acid and amine functional groups. It exhibits properties typical of both acids and amines, allowing it to participate in various chemical reactions, including acid-base reactions and nucleophilic substitutions. The presence of the pyridine ring contributes to its aromatic stability and potential biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its structure may allow for hydrogen bonding, influencing its solubility and reactivity. Overall, 2-Pyridinecarboxylic acid, 6-(aminocarbonyl)- is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C7H6N2O3
InChI:InChI=1S/C7H6N2O3/c8-6(10)4-2-1-3-5(9-4)7(11)12/h1-3H,(H2,8,10)(H,11,12)
InChI key:InChIKey=MUTVEWJASOPKGU-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C(C(O)=O)C=CC1
Synonyms:- 2-Pyridinecarboxylic acid, 6-(aminocarbonyl)-
- 6-(Aminocarbonyl)-2-pyridinecarboxylic acid
- 6-Carbamoylpicolinic acid
- 6-Carbamoylpyridine-2-carboxylic acid
- 6-Carbamoylpyridine-2-carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Carbamoylpyridine-2-carboxylic acid
CAS:6-Carbamoylpyridine-2-carboxylic acidFormula:C7H6N2O3Purity:95%Molecular weight:166.142-Pyridinecarboxylicacid, 6-(aminocarbonyl)-
CAS:Formula:C7H6N2O3Purity:95%Color and Shape:SolidMolecular weight:166.13416-Carbamoylpyridine-2-carboxylic acid
CAS:6-Carbamoylpyridine-2-carboxylic acidFormula:C7H6N2O3Purity:95%Molecular weight:166.136-Carbamoyl-pyridine-2-carboxylic Acid
CAS:Controlled ProductFormula:C7H6N2O3Color and Shape:NeatMolecular weight:166.136-Carbamoyl-pyridine-2-carboxylic acid
CAS:6-Carbamoyl-pyridine-2-carboxylic acid is a resonance form of the picolinic acid. The proton resonances are observed at 2.35, 2.41 and 2.53 ppm, while the picolinic acid has proton resonances at 4.04 ppm (proton) and 3.02 ppm (proton). The bifunctional nature of 6-carbamoyl-pyridine-2-carboxylic acid is due to an interaction between the carboxyl group on one end and the amine group on the other end, which may be due to its sialic and proton resonances. This compound is used as a molecular probe for biosynthesis studies in biochemical reactions, such as nucleotide synthesis or protein synthesis. 6-Carbamoyl-pyridine-2-carboxylic acid has been shown to have affinity to picolinic acid,Formula:C7H6N2O3Purity:Min. 95%Molecular weight:166.13 g/mol





