CAS 97336-41-9
:1H-Pyrrole-2-carboxylic acid, 3,4-diethyl-, ethyl ester
Description:
1H-Pyrrole-2-carboxylic acid, 3,4-diethyl-, ethyl ester, identified by its CAS number 97336-41-9, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its chemical reactivity and potential applications. The presence of diethyl substituents at the 3 and 4 positions of the pyrrole ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature can exhibit properties such as moderate solubility in organic solvents and varying degrees of stability depending on environmental conditions. They may also participate in various chemical reactions, including esterification and nucleophilic substitutions. The unique structural features of 1H-Pyrrole-2-carboxylic acid derivatives often make them of interest in medicinal chemistry and materials science, where they can serve as intermediates or active pharmaceutical ingredients.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-4-8-7-12-10(9(8)5-2)11(13)14-6-3/h7,12H,4-6H2,1-3H3
SMILES:CCc1c[nH]c(c1CC)C(=O)OCC
Synonyms:- 3,4-Diethyl-1H-pyrrole-2-carboxylic acid
- Ethyl 3,4-diethylpyrrole-2-carboxylate
- ethyl 3,4-diethyl-1H-pyrrole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Diethyl-1H-pyrrole-2-carboxylic acid ethyl ester
CAS:Formula:C11H17NO2Purity:97%Color and Shape:LiquidMolecular weight:195.25823,4-Diethyl-1H-pyrrole-2-carboxylic acid ethyl ester
CAS:3,4-Diethyl-1H-pyrrole-2-carboxylic acid ethyl esterFormula:C11H17NO2Purity:97%Molecular weight:195.25817Ethyl 3,4-diethyl-1H-pyrrole-2-carboxylate
CAS:Ethyl 3,4-diethyl-1H-pyrrole-2-carboxylateFormula:C11H17NO2Purity:97%Molecular weight:195.263,4-Diethyl-1H-pyrrole-2-carboxylic acid ethyl ester
CAS:3,4-Diethyl-1H-pyrrole-2-carboxylic acid ethyl ester is a chromophore in the porphyrin family. It is synthesized from 3,4-diethyl pyrrole and 1,2-ethanediol and can be used to make macrocycles. This compound reacts with chloroform in the presence of base to produce 4-(3,4-diethylphenoxy)benzaldehyde and acetone. This reaction is important for the production of cancer drugs such as methotrexate.Formula:C11H17NO2Purity:Min. 95%Molecular weight:195.26 g/mol




