CAS 97419-18-6

1-(2,6-Dimethyl-4-oxo-1(4H)-pyridinyl)pyridinium tetrafluoroborate

Description:

1-(2,6-Dimethyl-4-oxo-1(4H)-pyridinyl)pyridinium tetrafluoroborate is a chemical compound characterized by its pyridinium structure, which includes a pyridine ring substituted with a 2,6-dimethyl-4-oxo group. This compound is typically a salt, as indicated by the presence of the tetrafluoroborate anion (BF4^-), which is known for its stability and solubility in polar solvents. The presence of the dimethyl and keto groups contributes to its unique chemical reactivity and potential applications in organic synthesis and materials science. The tetrafluoroborate ion is a strong, non-coordinating anion that can enhance the solubility of the cation in various solvents. This compound may exhibit interesting properties such as ionic conductivity and could be utilized in electrochemical applications. Additionally, its structural features may influence its behavior in biological systems, although specific biological activity would require further investigation. Overall, this compound represents a class of pyridinium salts with potential utility in various chemical and industrial applications.

Formula: C12H13BF4N2O

InChI: InChI=1S/C12H13N2O.BF4/c1-10-8-12(15)9-11(2)14(10)13-6-4-3-5-7-13;2-1(3,4)5/h3-9H,1-2H3;/q+1;-1

InChI key: NCNCFKHLPONPQT-UHFFFAOYSA-N

SMILES: [B-](F)(F)(F)F.CC1=CC(=O)C=C(N1[N+]2=CC=CC=C2)C

Synonyms:

• 1-(2,6-Dimethyl-4-oxo-1(4H)-pyridinyl)pyridinium tetrafluoroborate

1-(2,6-Dimethyl-4-oxo-1(4H)-pyridinyl)pyridinium tetrafluoroborate

CAS: 97419-18-6

Formula: C₁₂H₁₃BF₄N₂O

Purity: 97%

Molecular weight: 288.05

Ref: 10-F182301