CymitQuimica logo

CAS 97454-46-1

:

N-ethyl-2-(ethylamino)-2-oxoethanaminium

Description:
N-ethyl-2-(ethylamino)-2-oxoethanaminium, with the CAS number 97454-46-1, is a quaternary ammonium compound characterized by its positive charge due to the presence of a quaternary nitrogen atom. This compound features an ethyl group attached to the nitrogen, along with an ethylamino group and a ketone functional group, which contributes to its reactivity and potential biological activity. It is typically soluble in polar solvents, which is common for quaternary ammonium compounds, and may exhibit surfactant properties. The presence of both an amino group and a ketone suggests potential interactions with biological systems, making it of interest in pharmaceutical and biochemical applications. Its structure allows for various interactions, including hydrogen bonding and ionic interactions, which can influence its behavior in different environments. As with many quaternary ammonium compounds, it may also possess antimicrobial properties, making it relevant in the development of disinfectants or antiseptics. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C6H15N2O
InChI:InChI=1/C6H14N2O/c1-3-7-5-6(9)8-4-2/h7H,3-5H2,1-2H3,(H,8,9)/p+1
Found 1 products.