CymitQuimica logo

CAS 97459-72-8

:

4-(2-methoxy-4-nitrophenyl)morpholine

Description:
4-(2-Methoxy-4-nitrophenyl)morpholine, with the CAS number 97459-72-8, is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound features a para-substituted nitrophenyl group, where a methoxy group is attached to the ortho position relative to the nitro group. The presence of both the methoxy and nitro substituents contributes to its electronic properties, potentially influencing its reactivity and solubility. Morpholine derivatives are often noted for their applications in pharmaceuticals and agrochemicals due to their ability to act as intermediates or active compounds. The compound may exhibit various physical properties such as solubility in organic solvents and moderate stability under standard conditions. Its specific applications and behavior in chemical reactions would depend on the functional groups present and their interactions with other molecules. Overall, 4-(2-methoxy-4-nitrophenyl)morpholine is of interest in synthetic organic chemistry and may have potential uses in medicinal chemistry.
Formula:C11H14N2O4
InChI:InChI=1/C11H14N2O4/c1-16-11-8-9(13(14)15)2-3-10(11)12-4-6-17-7-5-12/h2-3,8H,4-7H2,1H3
InChI key:KORWLDQABONDQH-UHFFFAOYSA-N
SMILES:COc1cc(ccc1N1CCOCC1)N(=O)=O
Synonyms:
  • Morpholine, 4-(2-Methoxy-4-Nitrophenyl)-
Found 3 products.