CAS 97465-70-8
:Tanshindiol B
Description:
Tanshindiol B, with the CAS number 97465-70-8, is a naturally occurring chemical compound classified as a terpenoid. It is primarily derived from certain plant sources, particularly those in traditional medicine. Tanshindiol B is characterized by its unique molecular structure, which contributes to its biological activity. It exhibits various pharmacological properties, including potential anti-inflammatory and antioxidant effects, making it of interest in medicinal chemistry and natural product research. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in formulations. Additionally, Tanshindiol B may interact with biological systems, influencing cellular pathways and potentially offering therapeutic benefits. However, further studies are necessary to fully elucidate its mechanisms of action and potential applications in health and disease. As with many natural compounds, the extraction and purification processes can significantly affect its yield and purity, which are critical for research and development purposes.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-8-7-23-17-10-3-5-11-9(4-6-12(19)18(11,2)22)14(10)16(21)15(20)13(8)17/h3,5,7,12,19,22H,4,6H2,1-2H3/t12-,18+/m0/s1
InChI key:InChIKey=RTKDBIDPGKCZJS-KPZWWZAWSA-N
SMILES:O=C1C=2C(C3=C(C1=O)C(C)=CO3)=CC=C4C2CC[C@H](O)[C@]4(C)O
Synonyms:- (6R,7S)-6,7,8,9-Tetrahydro-6,7-dihydroxy-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6,7-dihydroxy-1,6-dimethyl-, (6R-cis)-
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6,7-dihydroxy-1,6-dimethyl-, (6R,7S)-(-)-
- Tanshinodiol B
- Tanshindiol B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tanshindiol B
CAS:Tanshindiol B inhibits EZH2, has anti-cancer and anti-angiogenic properties, promising for designing potent inhibitors.Formula:C18H16O5Purity:98%Color and Shape:SolidMolecular weight:312.32Tanshindiol B
CAS:Tanshindiol B is a diterpenoid compound, which is a secondary metabolite extracted from the roots of Salvia miltiorrhiza, commonly known as danshen. This traditional Chinese medicinal plant is renowned for its rich array of bioactive constituents. The compound acts primarily through interaction with key molecular pathways involved in oxidative stress and inflammation, thus contributing to its potential therapeutic effects.
Formula:C18H16O5Purity:Min. 95%Molecular weight:312.30 g/mol



