CAS 97466-49-4
:Oxirane,2-(4-chlorophenyl)-, (2S)-
Description:
Oxirane, 2-(4-chlorophenyl)-, (2S)-, also known as a chiral epoxide, is characterized by its three-membered cyclic ether structure, which includes an oxirane ring and a 4-chlorophenyl substituent. This compound features a stereocenter, indicated by the (2S) designation, which contributes to its potential biological activity and reactivity. The presence of the chlorine atom on the phenyl ring enhances its electrophilic character, making it a useful intermediate in organic synthesis and pharmaceuticals. The epoxide functional group is known for its reactivity, particularly in nucleophilic ring-opening reactions, which can lead to the formation of various derivatives. Additionally, the compound's chirality may influence its interaction with biological systems, making it of interest in medicinal chemistry. Its physical properties, such as boiling point, melting point, and solubility, would typically depend on the specific molecular interactions and the presence of functional groups. Overall, this compound exemplifies the complexity and utility of chiral epoxides in chemical synthesis and potential applications in drug development.
Formula:C8H7ClO
InChI:InChI=1S/C8H7ClO/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8H,5H2/t8-/m1/s1
InChI key:IBWLXNDOMYKTAD-MRVPVSSYSA-N
SMILES:C1[C@@H](O1)C2=CC=C(C=C2)Cl
Synonyms:- Oxirane,(4-chlorophenyl)-, (2S)-
- Oxirane, (4-chlorophenyl)-, (S)-
- (+)-4'-Chlorostyrene oxide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2S)-2-(4-Chlorophenyl)oxirane
CAS:(2S)-2-(4-Chlorophenyl)oxiraneFormula:C8H7ClOPurity:97%Molecular weight:154.59(S)-2-(4-Chlorophenyl)oxirane
CAS:Formula:C8H7ClOPurity:97%Color and Shape:LiquidMolecular weight:154.5936(S)-4-Chlorostyrene Oxide
CAS:Controlled ProductApplications (S)-4-Chlorostyrene oxide is used in the biosynthetic preparation though epoxidation of styrene and substituted styrenes by whole cells of Mycobacterium.
References Rigby, S. R., et al.: Bioorg. Med. Chem. 2, 553 (1994);Formula:C8H7ClOColor and Shape:NeatMolecular weight:154.594(2S)-2-(4-Chlorophenyl)oxirane
CAS:(2S)-2-(4-Chlorophenyl)oxirane is an enantiopure epoxide that is used as a building block in organic synthesis. It is prepared by reacting styrene with peracetic acid, yielding the desired product in good isolated yield. The compound has been shown to inhibit the enzyme epoxide hydrolase and may be useful for the treatment of bacterial infections. (2S)-2-(4-Chlorophenyl)oxirane also has been shown to have anti-inflammatory activity, which may be due to its ability to induce apoptosis.
Formula:C8H7ClOPurity:Min. 95%Molecular weight:154.59 g/mol





