CymitQuimica logo

CAS 97480-49-4

:

(Chlorocarbonyl-difluoromethyl)-phosphonic acid diethyl ester

Description:
(Chlorocarbonyl-difluoromethyl)-phosphonic acid diethyl ester, with the CAS number 97480-49-4, is a chemical compound that belongs to the class of organophosphorus compounds. It features a phosphonic acid moiety, which is characterized by the presence of a phosphorus atom bonded to oxygen and carbon groups. This compound is notable for its chlorocarbonyl and difluoromethyl functional groups, which contribute to its reactivity and potential applications in various chemical processes. The presence of the diethyl ester groups indicates that it can undergo hydrolysis to form the corresponding phosphonic acid, which may exhibit biological activity. Generally, compounds of this nature are of interest in fields such as agrochemicals, pharmaceuticals, and materials science due to their ability to interact with biological systems and their utility in synthetic chemistry. Safety and handling precautions are essential when working with this compound, as organophosphorus compounds can exhibit toxicity and environmental persistence.
Formula:C6H10ClF2O4P
InChI:InChI=1/C6H10ClF2O4P/c1-3-12-14(11,13-4-2)6(8,9)5(7)10/h3-4H2,1-2H3
SMILES:CCOP(=O)(C(C(=O)Cl)(F)F)OCC
Synonyms:
  • Diethyl (2-Chloro-1,1-Difluoro-2-Oxoethyl)Phosphonate
Found 1 products.