CAS 97534-21-9
:Merbarone
Description:
Merbarone is a synthetic compound classified as a selective inhibitor of the enzyme topoisomerase II, which plays a crucial role in DNA replication and cell division. Its chemical structure features a unique arrangement that contributes to its biological activity, making it of interest in cancer research for its potential therapeutic applications. Merbarone has been studied for its ability to induce apoptosis in cancer cells, thereby inhibiting tumor growth. The compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which can influence its bioavailability and pharmacokinetics. Additionally, Merbarone exhibits a specific mechanism of action that differentiates it from other topoisomerase inhibitors, potentially leading to varied side effects and efficacy profiles. As with many chemical substances, safety and handling precautions are essential due to its biological activity, and ongoing research continues to explore its full potential in oncology and other therapeutic areas.
Formula:C11H9N3O3S
InChI:InChI=1S/C11H9N3O3S/c15-8(12-6-4-2-1-3-5-6)7-9(16)13-11(18)14-10(7)17/h1-5,7H,(H,12,15)(H2,13,14,16,17,18)
InChI key:InChIKey=JARCFMKMOFFIGZ-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2C(=O)NC(=S)NC2=O
Synonyms:- 4,6-dioxo-N-phenyl-2-thioxohexahydropyrimidine-5-carboxamide
- 5-(N-Phenylcarboxamido)-2-thiobarbituric acid
- 5-Pyrimidinecarboxamide, hexahydro-4,6-dioxo-N-phenyl-2-thioxo-
- 6-hydroxy-4-oxo-N-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
- Ccris 8215
- Hexahydro-4,6-dioxo-N-phenyl-2-thioxo-5-pyrimidinecarboxamide
- Nsc 336628
- Merbarone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Merbarone
CAS:Merbarone is a Type II DNA topoisomerase inhibitor. Merbarone inhibits the catalytic activity of human topoisomerase IIalpha by blocking DNA cleavage. Merbarone induces activation of caspase-activated DNase and excision of chromosomal DNA loops from the nFormula:C11H9N3O3SColor and Shape:SolidMolecular weight:263.27Merbarone
CAS:Merbarone is a cytotoxic agent that inhibits the growth of cancer cells by binding to the nuclear DNA. It has been shown to bind to topoisomerase II and inhibit DNA synthesis in vitro. Merbarone also has potent antitumor activity in vivo and induces apoptosis in squamous carcinoma cells. This drug also interferes with the oxidative injury pathway, which may be due to its ability to induce apoptosis in malignant brain cells. Merbarone has been shown to have genotoxic effects on k562 cells, which may be due to its ability to inhibit topoisomerase I and II enzymes.
Formula:C11H9N3O3SPurity:Min. 95%Molecular weight:263.27 g/mol



