CymitQuimica logo

CAS 97582-88-2

:

3-(difluoromethoxy)benzonitrile

Description:
3-(Difluoromethoxy)benzonitrile is an organic compound characterized by the presence of a benzonitrile moiety, which features a cyano group (-CN) attached to a benzene ring. The compound also contains a difluoromethoxy group (-O-CHF2) at the meta position relative to the cyano group. This substitution pattern influences its chemical properties, including polarity and reactivity. The difluoromethoxy group enhances the compound's lipophilicity and may affect its interaction with biological systems, making it of interest in medicinal chemistry and material science. The presence of fluorine atoms typically imparts unique electronic properties, potentially increasing the compound's stability and altering its solubility in various solvents. Additionally, the cyano group contributes to the compound's ability to participate in nucleophilic reactions. Overall, 3-(difluoromethoxy)benzonitrile is a versatile compound with applications in pharmaceuticals and agrochemicals, where its specific functional groups can be leveraged for targeted chemical reactivity and biological activity.
Formula:C8H5F2NO
InChI:InChI=1/C8H5F2NO/c9-8(10)12-7-3-1-2-6(4-7)5-11/h1-4,8H
InChI key:JCBOPIBHZFBHQW-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OC(F)F)C#N
Found 5 products.