CymitQuimica logo

CAS 97605-25-9

:

Isoscoparin-2′′O-glucoside

Description:
Isoscoparin-2′′O-glucoside is a flavonoid glycoside, a type of compound commonly found in various plants, particularly in the family of herbs and vegetables. This compound is characterized by its structure, which includes a flavonoid aglycone linked to a glucose molecule through a glycosidic bond. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmacological research. Isoscoparin-2′′O-glucoside is often studied for its role in traditional medicine and its potential health benefits. Its solubility and stability can vary depending on environmental conditions, such as pH and temperature. Additionally, like many flavonoids, it may contribute to the color and flavor of the plants in which it is found. The compound's specific interactions with biological systems and its mechanisms of action are areas of ongoing research, highlighting its significance in both natural product chemistry and therapeutic applications.
Formula:C28H32O16
InChI:InChI=1S/C28H32O16/c1-40-14-4-9(2-3-10(14)31)13-5-11(32)18-15(41-13)6-12(33)19(22(18)36)26-27(24(38)21(35)16(7-29)42-26)44-28-25(39)23(37)20(34)17(8-30)43-28/h2-6,16-17,20-21,23-31,33-39H,7-8H2,1H3/t16-,17-,20-,21-,23+,24+,25-,26+,27-,28+/m1/s1
InChI key:InChIKey=AQQFWSYLUDMDBP-ODEMIOGVSA-N
SMILES:OC=1C(=C(O)C=C2C1C(=O)C=C(O2)C3=CC(OC)=C(O)C=C3)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4
Synonyms:
  • Isoscoparin-2′′O-glucoside
  • 6-(2-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
  • 4H-1-Benzopyran-4-one, 6-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-
Found 6 products.