CymitQuimica logo

CAS 97608-49-6

:

1,3-Dichloro-2-(trifluoromethoxy)benzene

Description:
1,3-Dichloro-2-(trifluoromethoxy)benzene is an aromatic compound characterized by the presence of two chlorine atoms and a trifluoromethoxy group attached to a benzene ring. The molecular structure features a benzene core, which contributes to its stability and hydrophobic nature. The dichloro substituents introduce significant electronegativity, influencing the compound's reactivity and polarity. The trifluoromethoxy group enhances the compound's lipophilicity and can affect its solubility in various organic solvents. This compound is typically used in chemical synthesis and may serve as an intermediate in the production of agrochemicals or pharmaceuticals. Its physical properties, such as boiling point and melting point, are influenced by the halogen substituents, which can also impart unique chemical reactivity. Safety considerations are important when handling this compound, as it may pose environmental and health risks due to its halogenated nature. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.
Formula:C7H3Cl2F3O
InChI:InChI=1S/C7H3Cl2F3O/c8-4-2-1-3-5(9)6(4)13-7(10,11)12/h1-3H
InChI key:RIVHTVHBEUJLSP-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)Cl)OC(F)(F)F)Cl
Synonyms:
  • 2,6-Dichelorotrifluoromethoxybenzene
  • 2,6-Dichlorotrifluoromethoxybenzene
Found 3 products.