CymitQuimica logo

CAS 97608-50-9

:

4-chloro-3-(trifluoromethoxy)aniline

Description:
4-Chloro-3-(trifluoromethoxy)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a trifluoromethoxy group. The presence of the chloro group introduces a degree of electron-withdrawing character, influencing the compound's reactivity and solubility. The trifluoromethoxy group, consisting of a methoxy group where three hydrogen atoms are replaced by fluorine atoms, significantly enhances the compound's lipophilicity and can affect its biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique functional groups make it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the trifluoromethoxy group can impart unique properties, such as increased metabolic stability and altered interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H5ClF3NO
InChI:InChI=1S/C7H5ClF3NO/c8-5-2-1-4(12)3-6(5)13-7(9,10)11/h1-3H,12H2
InChI key:RWTSQATWCKAOBB-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1N)OC(F)(F)F)Cl
Found 4 products.