CymitQuimica logo

CAS 97614-47-6

:

2,4(1H,3H)-Pyrimidinedione,1-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-arabinofuranosyl)-5-methyl-

Description:
2,4(1H,3H)-Pyrimidinedione, 1-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-arabinofuranosyl)-5-methyl- is a complex organic compound characterized by its pyrimidinedione core, which features a methyl group at the 5-position and a substituted arabinofuranosyl moiety. The presence of the 3,5-di-O-benzoyl groups indicates that the molecule has been modified to enhance its stability and solubility, which is often crucial for biological activity. The incorporation of a fluorine atom at the 2-deoxy position suggests potential applications in medicinal chemistry, particularly in antiviral or anticancer drug development, as fluorinated nucleosides can exhibit improved metabolic stability. This compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit specific optical activity due to its chiral centers. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in pharmaceutical research. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C24H21FN2O7
InChI:InChI=1S/C24H21FN2O7/c1-14-12-27(24(31)26-20(14)28)21-18(25)19(34-23(30)16-10-6-3-7-11-16)17(33-21)13-32-22(29)15-8-4-2-5-9-15/h2-12,17-19,21H,13H2,1H3,(H,26,28,31)/t17-,18+,19-,21-/m1/s1
InChI key:CEPDPXNYCRCFRV-RCLSDMTESA-N
SMILES:CC1=CN(C(=O)NC1=O)[C@H]2[C@H]([C@@H]([C@H](O2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)F
Synonyms:
  • 2,4(1H,3H)-Pyrimidinedione, 1-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-尾-D-arabinofuranosyl)-5-methyl-
Found 2 products.