CAS 97653-93-5
:(5α,7β)-7-Hydroxy-4,4,14-trimethylpregn-8-ene-3,11,15,20-tetrone
Description:
(5α,7β)-7-Hydroxy-4,4,14-trimethylpregn-8-ene-3,11,15,20-tetrone, with CAS number 97653-93-5, is a steroid compound characterized by its complex structure, which includes multiple functional groups and a steroid backbone. This compound features a hydroxyl group at the 7-position, contributing to its potential biological activity. The presence of four ketone groups at positions 3, 11, 15, and 20 indicates that it may participate in various chemical reactions and interactions, particularly in biological systems. The trimethyl groups at positions 4, 4, and 14 suggest steric hindrance, which can influence the compound's conformation and reactivity. This steroid derivative may exhibit pharmacological properties, making it of interest in medicinal chemistry and biochemistry. Its specific interactions and effects would depend on its stereochemistry and the presence of other substituents, which can affect its solubility, stability, and biological activity. Further studies would be necessary to elucidate its full range of characteristics and potential applications.
Formula:C24H32O5
InChI:InChI=1S/C24H32O5/c1-12(25)13-9-18(29)24(6)20-14(26)10-16-21(2,3)17(28)7-8-22(16,4)19(20)15(27)11-23(13,24)5/h13-14,16,26H,7-11H2,1-6H3/t13-,14+,16+,22+,23-,24+/m1/s1
InChI key:InChIKey=AJULRUMEMZKBQI-YZISURJTSA-N
SMILES:C[C@@]12C3=C([C@@]4(C)[C@](C)(CC3=O)[C@@H](C(C)=O)CC4=O)[C@@H](O)C[C@]1(C(C)(C)C(=O)CC2)[H]
Synonyms:- Pregn-8-ene-3,11,15,20-tetrone, 7-hydroxy-4,4,14-trimethyl-, (5α,7β)-
- (5α,7β)-7-Hydroxy-4,4,14-trimethylpregn-8-ene-3,11,15,20-tetrone
- Lucidone B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(5α,7β)-7-Hydroxy-4,4,14-trimethylpregn-8-ene-3,11,15,20-tetrone
CAS:(5α,7β)-7-Hydroxy-4,4,14-trimethylpregn-8-ene-3,11,15,20-tetroneFormula:C24H32O5Purity:≥98%Molecular weight:400.51Lucidone B
CAS:Lucidone B is a natural productFormula:C24H32O5Purity:98%Color and Shape:SolidMolecular weight:400.51Lucidone B
CAS:Controlled ProductLucidone B is a drug that has been shown to have anti-cancer, anti-inflammatory and hepatoprotective properties. The mechanism of action is not well understood, but it appears to have a positive effect on the liver by inhibiting the production of tumor necrosis factor. It also induces apoptosis in cancer cells and reduces inflammation by inhibiting the production of inflammatory cytokines. Lucidone B may act as an antioxidant and protect against oxidative damage caused by free radicals. Lucidone B has been shown to be effective in treating Hepatitis C virus infection by inhibiting viral replication.
Formula:C24H32O5Purity:Min. 95%Molecular weight:400.5 g/mol




