CAS 97653-94-6
:Ganoderic acid D2
Description:
Ganoderic acid D2 is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is part of a larger class of ganoderic acids, which are known for their diverse biological activities. Ganoderic acid D2 exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. Its structure features multiple hydroxyl groups and a complex ring system, contributing to its bioactivity and solubility characteristics. The compound has garnered interest in traditional medicine and modern pharmacology for its potential health benefits, including immune system modulation and liver protection. Additionally, research into ganoderic acids, including D2, continues to explore their mechanisms of action and therapeutic applications. However, further studies are necessary to fully understand their efficacy and safety profiles in clinical settings. As with many natural products, the extraction and purification processes can influence the yield and activity of ganoderic acid D2, making standardization an important consideration in its use.
Formula:C30H42O8
InChI:InChI=1S/C30H42O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17-19,25,32,36H,8-13H2,1-7H3,(H,37,38)
InChI key:InChIKey=LCIUOVOXWPIXOR-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(=O)CC4)C(=O)C(O)C1(C)C(C(CC(CC(C(O)=O)C)=O)C)CC2=O
Synonyms:- (7β,12β)-7,12-Dihydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
- Ganoderic acid D2
- Lanost-8-En-26-Oic Acid, 7-Hydroxy-3,11,15,23-Tetraoxo-, (7Beta)-
- Lanost-8-en-26-oic acid, 7,12-dihydroxy-3,11,15,23-tetraoxo-, (7β,12β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderic acid D2
CAS:Ganoderic acid D2 is a natural productFormula:C30H42O8Purity:98%Color and Shape:SolidMolecular weight:530.658Ganoderic acid D2
CAS:Controlled ProductGanoderic acid D2 is a reactive, radical scavenging compound with antioxidant properties. It has been shown to have neuroprotective effects in animal models of Parkinson’s disease and chromatographic techniques on human erythrocytes. Ganoderic acid D2 also has anticancer activity and is able to inhibit telomerase activity by binding to the DNA template. In addition, ganoderic acid D2 inhibits the production of nitric oxide and prostaglandin E2 in vitro, which may be due to its ability to inhibit the enzyme cyclooxygenase-1 (COX-1). This extract also blocks cell proliferation induced by growth factors such as platelet-derived growth factor (PDGF) or epidermal growth factor (EGF).
Purity:Min. 95%




