CAS 97657-92-6
:2,8-dimethyl-5-[2-(6-methyl-3-pyridyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole hydrochloride
Description:
2,8-Dimethyl-5-[2-(6-methyl-3-pyridyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole hydrochloride is a complex organic compound characterized by its multi-ring structure, which includes a pyridoindole framework. This compound features multiple methyl groups and a pyridine moiety, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit various pharmacological effects, although specific biological activities would depend on further empirical studies. The compound's CAS number, 97657-92-6, allows for precise identification in chemical databases, facilitating research and development in related fields. Overall, this substance exemplifies the complexity and diversity of organic compounds used in drug discovery and development.
Formula:C21H26ClN3
InChI:InChI=1/C21H25N3.ClH/c1-15-4-7-20-18(12-15)19-14-23(3)10-9-21(19)24(20)11-8-17-6-5-16(2)22-13-17;/h4-7,12-13H,8-11,14H2,1-3H3;1H
SMILES:Cc1ccc2c(c1)c1CN(C)CCc1n2CCc1ccc(C)nc1.Cl
Synonyms:- 2,3,4,5-Tetrahydro-2,8-Dimethyl-5-[2-(6-Methyl-3-Pyridyl)Ethyl]-1H-Pyrido[4,3-B]Indole Dihydrochloride
- Dimebone HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dimebolin dihydrochloride
CAS:Formula:C21H25N3Purity:99%Color and Shape:SolidMolecular weight:319.44332,8-Dimethyl-5-(2-(6-methylpyridin-3-yl)ethyl)-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole dihydrochloride
CAS:2,8-Dimethyl-5-(2-(6-methylpyridin-3-yl)ethyl)-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole dihydrochlorideFormula:C21H27Cl2N3Purity:99%Molecular weight:392.37Latrepirdine dihydrochloride
CAS:Latrepirdine dihydrochloride (Dimebolin dihydrochloride) is an orally active, and neuroactive antagonist of multiple drug targets.Formula:C21H25N3·2HClPurity:98.45%Color and Shape:SolidMolecular weight:392.37Latrepirdine Dihydrochloride
CAS:Controlled ProductApplications Latrepirdine is an antihistamine drug used initially in Russia. Recently research have explore the potential of Latrepirdine to demonstrate activities against neurodegenerative conditions.
References Steele, J.W. et al.: Mol. Psychiatry., 10, 115 (2012); Zhang, S., et al.: J. Alzheimers, Dis., 21, 389 (2010);Formula:C21H25N3·2ClHColor and Shape:NeatMolecular weight:392.365






