CymitQuimica logo

CAS 97664-55-6

:

Benzenemethanamine,N-[6-(4-phenylbutoxy)hexyl]-

Description:
Benzenemethanamine, N-[6-(4-phenylbutoxy)hexyl]- is an organic compound characterized by its amine functional group and a complex alkyl side chain. The structure features a benzene ring attached to a methanamine moiety, which is further substituted with a hexyl chain that includes a phenylbutoxy group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the phenyl and butoxy groups suggests potential hydrophobic characteristics, which may affect its interaction with biological membranes and its overall bioactivity. Additionally, the compound may have applications in pharmaceuticals or as a chemical intermediate due to its unique structural features. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance, particularly those with amine functionalities.
Formula:C23H33NO
InChI:InChI=1S/C23H33NO/c1(10-18-24-21-23-16-7-4-8-17-23)2-11-19-25-20-12-9-15-22-13-5-3-6-14-22/h3-8,13-14,16-17,24H,1-2,9-12,15,18-21H2
InChI key:JWLIKZBRVQRFNF-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CCCCOCCCCCCNCC2=CC=CC=C2
Synonyms:
  • N-Benzyl-6-(4-phenylbutoxy)hexan-1-amine
  • [6-(4-Phenylbutoxy)hexyl]benzylamine
Found 3 products.