CAS 97664-58-9

1-Hexanamine, 6-(4-phenylbutoxy)-

Description:

1-Hexanamine, 6-(4-phenylbutoxy)-, with the CAS number 97664-58-9, is an organic compound characterized by its amine functional group and a long hydrocarbon chain. This substance features a hexanamine backbone, which contributes to its basicity and potential reactivity, particularly in nucleophilic substitution reactions. The presence of the 4-phenylbutoxy group enhances its hydrophobic properties, making it more soluble in organic solvents than in water. This compound may exhibit biological activity due to its amine functionality, which can interact with various biological targets. Additionally, its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a surfactant. The physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall molecular weight. Safety data should be consulted for handling and usage, as amines can be irritants and may pose health risks. Overall, 1-Hexanamine, 6-(4-phenylbutoxy)- is a compound of interest in both synthetic chemistry and potential applications in various fields.

Formula: C₁₆H₂₇NO

InChI: InChI=1S/C16H27NO/c17-13-7-1-2-8-14-18-15-9-6-12-16-10-4-3-5-11-16/h3-5,10-11H,1-2,6-9,12-15,17H2

InChI key: GNSOSZKMHANCMP-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)CCCCOCCCCCCN

Synonyms:

• Salmeterol Impurity 9

Salmeterol Impurity 9

CAS: 97664-58-9

Formula: C₁₆H₂₇NO

Molecular weight: 249.40

Ref: 4Z-S-1620

6-(4-Phenylbutoxy)-1-hexanamine

CAS: 97664-58-9

Applications 6-(4-Phenylbutoxy)-1-hexanamine is an intermediate in the synthesis of salmeterol (S090100), a structural analog of Albuterol (A514500).
References Goswami, J., et al.: Tetrahedron. Asym., 12, 3343 (2002);

Formula: C₁₆H₂₇NO

Color and Shape: Neat

Molecular weight: 249.39

Ref: TR-P297920