CymitQuimica logo

CAS 97685-00-2

:

N-[[4-[2-[4-(Dimethylamino)phenyl]diazenyl]phenyl]sulfonyl]-L-tryptophan

Description:
N-[[4-[2-[4-(Dimethylamino)phenyl]diazenyl]phenyl]sulfonyl]-L-tryptophan, identified by its CAS number 97685-00-2, is a synthetic compound that features a complex structure combining an amino acid (L-tryptophan) with a sulfonyl group and a diazenyl moiety. This compound is characterized by its azo linkage, which is indicative of azo compounds known for their vibrant colors and potential applications in dyes and pigments. The presence of the dimethylamino group suggests that it may exhibit basic properties, influencing its solubility and reactivity. The sulfonyl group can enhance the compound's stability and solubility in polar solvents. Additionally, the tryptophan component may impart biological activity, as tryptophan is an essential amino acid involved in various metabolic processes. Overall, this compound's unique structural features may allow for diverse applications in fields such as pharmaceuticals, materials science, and biochemistry, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C25H25N5O4S
InChI:InChI=1S/C25H25N5O4S/c1-30(2)20-11-7-18(8-12-20)27-28-19-9-13-21(14-10-19)35(33,34)29-24(25(31)32)15-17-16-26-23-6-4-3-5-22(17)23/h3-14,16,24,26,29H,15H2,1-2H3,(H,31,32)/t24-/m0/s1
InChI key:InChIKey=SGKGZXUAHWJTIA-DEOSSOPVSA-N
SMILES:C([C@H](NS(=O)(=O)C1=CC=C(N=NC2=CC=C(N(C)C)C=C2)C=C1)C(O)=O)C=3C=4C(NC3)=CC=CC4
Synonyms:
  • N-[[4-[2-[4-(Dimethylamino)phenyl]diazenyl]phenyl]sulfonyl]-L-tryptophan
  • L-Tryptophan, N-[[4-[2-[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl]-
  • L-Tryptophan, N-[[4-[[4-(dimethylamino)phenyl]azo]phenyl]sulfonyl]-
Found 2 products.