CymitQuimica logo

CAS 97748-75-9

:

Uridine, 2'-azido-2'-deoxy-5-methyl-

Description:
Uridine, 2'-azido-2'-deoxy-5-methyl- is a modified nucleoside that features an azido group at the 2' position and a methyl group at the 5' position of the ribose sugar. This compound is part of the broader category of nucleoside analogs, which are often studied for their potential applications in antiviral and anticancer therapies. The presence of the azido group can enhance the compound's reactivity and may facilitate incorporation into nucleic acids, potentially affecting their biological activity. The methyl group at the 5' position can influence the stability and binding affinity of the nucleoside to various enzymes and receptors. As a synthetic derivative of uridine, this compound may exhibit unique pharmacological properties compared to its natural counterparts. Its chemical structure allows for various modifications that can be explored in medicinal chemistry, particularly in the development of therapeutics targeting RNA viruses or in gene therapy applications. Overall, the characteristics of this compound make it a subject of interest in biochemical research and drug development.
Formula:C10H13N5O5
InChI:InChI=1S/C10H13N5O5/c1-4-2-15(10(19)12-8(4)18)9-6(13-14-11)7(17)5(3-16)20-9/h2,5-7,9,16-17H,3H2,1H3,(H,12,18,19)/t5-,6-,7-,9-/m1/s1
InChI key:JEIPQKWFUIEONT-JXOAFFINSA-N
SMILES:CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)N=[N+]=[N-]
Synonyms:
  • 2'-Azido-2'-deoxy-5-methyl uridine
Found 1 products.