CymitQuimica logo

CAS 97760-97-9

:

2-Amino-5-iodobenzotrifluoride

Description:
2-Amino-5-iodobenzotrifluoride, with the CAS number 97760-97-9, is an organic compound characterized by the presence of an amino group (-NH2), an iodine atom, and three trifluoromethyl groups (-CF3) attached to a benzene ring. This compound is a derivative of benzene, where the amino group is positioned at the second carbon and the iodine and trifluoromethyl groups are located at the fifth and other positions, respectively. The presence of the trifluoromethyl groups imparts significant electronegativity and lipophilicity, influencing the compound's reactivity and solubility. 2-Amino-5-iodobenzotrifluoride is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound is of interest in both academic research and industrial applications due to its distinctive chemical properties.
Formula:C7H5F3IN
InChI:InChI=1/C7H5F3IN/c8-7(9,10)5-3-4(11)1-2-6(5)12/h1-3H,12H2
InChI key:MAJKZNONEQIIGP-UHFFFAOYSA-N
SMILES:c1cc(c(cc1I)C(F)(F)F)N
Synonyms:
  • 4-Iodo-2-(Trifluoromethyl)Aniline
Found 4 products.