CAS 97791-84-9
:L-Threonine, L-lysyl-
Description:
L-Threonine, L-lysyl- is a dipeptide composed of the amino acids L-threonine and L-lysine. It is characterized by its structure, which includes the amino group, carboxyl group, and side chains of both constituent amino acids. This compound is typically soluble in water due to the presence of polar functional groups, which facilitate hydrogen bonding. L-Threonine is an essential amino acid, meaning it must be obtained through diet, while L-lysine is also essential and plays a crucial role in protein synthesis, hormone production, and calcium absorption. The dipeptide form may exhibit unique biological activities, including potential roles in metabolism and cellular functions. Additionally, it may be involved in various biochemical pathways, contributing to the synthesis of proteins and other biomolecules. The CAS number 97791-84-9 uniquely identifies this compound in chemical databases, aiding in its study and application in fields such as biochemistry, nutrition, and pharmaceuticals.
Formula:C10H21N3O4
InChI:InChI=1S/C10H21N3O4/c1-6(14)8(10(16)17)13-9(15)7(12)4-2-3-5-11/h6-8,14H,2-5,11-12H2,1H3,(H,13,15)(H,16,17)/t6-,7+,8+/m1/s1
InChI key:ZOKVLMBYDSIDKG-CSMHCCOUSA-N
SMILES:C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Lysyl threonine
CAS:Lysyl threonine is a dipeptide composed of lysine and threonine. It is an incomplete breakdown product of protein digestion or protein catabolism.Formula:C10H21N3O4Color and Shape:SolidMolecular weight:247.29
