CAS 97845-72-2

Formula: C14H19N5O5

InChI: InChI=1S/C14H19N5O5/c1-8(20)23-5-10(6-24-9(2)21)3-4-19-7-16-11-12(19)17-14(15)18-13(11)22/h7,10H,3-6H2,1-2H3,(H3,15,17,18,22)

InChI key: KQURMIWGELPUHQ-UHFFFAOYSA-N

SMILES: CC(=O)OCC(CCN1C=NC2=C1N=C(NC2=O)N)COC(=O)C

Penciclovir Impurity 3

CAS: 97845-72-2

Formula: C₁₄H₁₉N₅O₅

Molecular weight: 337.34

Ref: 4Z-P-036

Penciclovir Diacetate

Controlled Product

CAS: 97845-72-2

Formula: C₁₄H₁₉N₅O₅

Color and Shape: Neat

Molecular weight: 337.33

Ref: TR-P221505

Penciclovir diacetate

CAS: 97845-72-2

Penciclovir diacetate is an antiviral compound, which is synthesized as a prodrug derivative of penciclovir. This compound originates from chemical modification processes designed to improve the pharmacokinetic properties of its active metabolite. Once administered, penciclovir diacetate undergoes in vivo conversion to penciclovir, an active nucleoside analog. The mode of action involves selective inhibition of viral DNA polymerase after being phosphorylated to its triphosphate form, thereby impeding viral DNA synthesis and replication.

Formula: C₁₄H₁₉N₅O₅

Purity: Min. 95%

Molecular weight: 337.33 g/mol

Ref: 3D-XDA84572

Penciclovir Impurity C

CAS: 97845-72-2

Formula: C₁₄H₁₉N₅O₅

Molecular weight: 337.34

Ref: ST-EA-CP-P5003