CymitQuimica logo

CAS 97892-66-5

:

7-Chloro-4-hydrazinyl-2-methylquinoline

Description:
7-Chloro-4-hydrazinyl-2-methylquinoline is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 7-position and a hydrazinyl group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its hydrazinyl functional group can participate in various chemical reactions, including those involving nucleophilic substitution and condensation, making it of interest in medicinal chemistry and drug development. The compound may also exhibit antimicrobial or antitumor properties, as many quinoline derivatives are known for their biological activities. Safety data should be consulted, as compounds containing hydrazine derivatives can be hazardous. Overall, 7-Chloro-4-hydrazinyl-2-methylquinoline represents a class of compounds that are valuable in research and potential therapeutic applications.
Formula:C10H10ClN3
InChI:InChI=1S/C10H10ClN3/c1-6-4-10(14-12)8-3-2-7(11)5-9(8)13-6/h2-5H,12H2,1H3,(H,13,14)
InChI key:InChIKey=OJXSAMCCXSURIW-UHFFFAOYSA-N
SMILES:N(N)C=1C2=C(N=C(C)C1)C=C(Cl)C=C2
Synonyms:
  • (7-Chloro-2-methylquinolin-4-yl)hydrazine
  • 2-Methyl-4-hydrazino-7-chloroquinoline
  • 7-Chloro-4-Hydrazinyl-2-Methylquinoline
  • Quinoline, 7-chloro-4-hydrazino-2-methyl-
  • Quinoline, 7-chloro-4-hydrazinyl-2-methyl-
Found 1 products.