CymitQuimica logo

CAS 97914-61-9

:

Benzoic acid, 2-chloro-4-(difluoromethoxy)-

Description:
Benzoic acid, 2-chloro-4-(difluoromethoxy)-, also known by its CAS number 97914-61-9, is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety with a chloro substituent and a difluoromethoxy group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of the chloro and difluoromethoxy groups can influence its reactivity and polarity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the difluoromethoxy group may impart unique electronic properties, affecting the compound's behavior in biological systems and its potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C8H5ClF2O3
InChI:InChI=1S/C8H5ClF2O3/c9-6-3-4(14-8(10)11)1-2-5(6)7(12)13/h1-3,8H,(H,12,13)
InChI key:InChIKey=RINVJRYLUFEKIP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(OC(F)F)C=C1
Synonyms:
  • Benzoic acid, 2-chloro-4-(difluoromethoxy)-
  • 2-Chloro-4-(difluoromethoxy)benzoic acid
Found 2 products.