CymitQuimica logo

CAS 97944-41-7

:

3-Bromo-2-methyl-4-pyridinamine

Description:
3-Bromo-2-methyl-4-pyridinamine, with the CAS number 97944-41-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine atom and a methyl group attached to the pyridine ring, specifically at the 3 and 2 positions, respectively, along with an amino group at the 4 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The bromine atom introduces a halogen, which can participate in substitution reactions, while the amino group can act as a nucleophile. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Bromo-2-methyl-4-pyridinamine is of interest for its potential utility in synthetic organic chemistry.
Formula:C6H7BrN2
InChI:InChI=1S/C6H7BrN2/c1-4-6(7)5(8)2-3-9-4/h2-3H,1H3,(H2,8,9)
InChI key:InChIKey=ZMQJEWNCZJALJI-UHFFFAOYSA-N
SMILES:BrC=1C(N)=CC=NC1C
Synonyms:
  • 3-Bromo-2-methyl-4-pyridinamine
  • 4-Amino-3-bromo-2-methylpyridine
  • 4-Pyridinamine, 3-bromo-2-methyl-
Found 4 products.