CymitQuimica logo

CAS 97944-42-8

:

3-Chloro-5-methyl-4-pyridinamine

Description:
3-Chloro-5-methyl-4-pyridinamine, with the CAS number 97944-42-8, is an organic compound that belongs to the class of pyridinamines. It features a pyridine ring substituted with a chlorine atom at the 3-position and a methyl group at the 5-position, along with an amino group at the 4-position. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the methyl group can affect the compound's steric properties and electronic characteristics. 3-Chloro-5-methyl-4-pyridinamine may have applications in pharmaceuticals or agrochemicals, given the importance of pyridine derivatives in these fields. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C6H7ClN2
InChI:InChI=1S/C6H7ClN2/c1-4-2-9-3-5(7)6(4)8/h2-3H,1H3,(H2,8,9)
InChI key:InChIKey=GLKVMXXYMNTCJX-UHFFFAOYSA-N
SMILES:NC=1C(C)=CN=CC1Cl
Synonyms:
  • 4-Pyridinamine, 3-chloro-5-methyl-
  • 3-Chloro-5-methyl-4-pyridinamine
Found 4 products.