CAS 98-28-2
:4-tert-Butyl-2-chlorophenol
Description:
4-tert-Butyl-2-chlorophenol, with the CAS number 98-28-2, is an organic compound that belongs to the class of chlorophenols. It features a chlorinated phenolic structure, where a chlorine atom is substituted at the 2-position of the phenol ring, and a tert-butyl group is attached at the 4-position. This compound is typically a white to light yellow solid at room temperature and is known for its moderate solubility in organic solvents while being less soluble in water. It exhibits antimicrobial properties, making it useful in various applications, including as a preservative in cosmetics and personal care products. The presence of both the chlorophenol and tert-butyl groups contributes to its chemical reactivity and stability. Additionally, 4-tert-Butyl-2-chlorophenol can undergo various chemical reactions typical of phenolic compounds, such as electrophilic substitution and oxidation. Safety considerations include potential toxicity and environmental impact, necessitating careful handling and disposal in accordance with regulatory guidelines.
Formula:C10H13ClO
InChI:InChI=1S/C10H13ClO/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6,12H,1-3H3
InChI key:InChIKey=PRLINSMUYJWPBL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(Cl)=C(O)C=C1
Synonyms:- 2-Chloro-4-(1,1-dimethylethyl)phenol
- 2-Chloro-4-tert-butylphenol
- Ai3-00060
- Nsc 8464
- Phenol, 2-chloro-4-(1,1-dimethylethyl)-
- Phenol, 4-tert-butyl-2-chloro-
- Phenol, 4-tert-butyl-2-chloro- (8CI)
- 4-tert-Butyl-2-chlorophenol
- 4-tert-Butyl-2-chlorophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Tert-butyl-2-chlorophenol
CAS:4-Tert-butyl-2-chlorophenolFormula:C10H13ClOPurity:99%Molecular weight:184.664-(tert-Butyl)-2-chlorophenol
CAS:4-(tert-Butyl)-2-chlorophenolFormula:C10H13ClOPurity:95%Molecular weight:184.664-tert-Butyl-2-chlorophenol(TechnicalGrade)
CAS:Formula:C10H13ClOPurity:95%Color and Shape:SolidMolecular weight:184.66264-tert-Butyl-2-chlorophenol (Technical Grade)
CAS:Controlled ProductApplications 4-tert-Butyl-2-chlorophenol
Formula:C10H13ClOColor and Shape:NeatMolecular weight:184.664-tert-Butyl-2-chlorophenol-d9
CAS:Controlled ProductApplications 4-tert-Butyl-2-chlorophenol-d9 is the labelled analogue of 4-tert-Butyl-2-chlorophenol.
Formula:C10D9H4ClOColor and Shape:NeatMolecular weight:193.7184-tert-Butyl-2-chlorophenol (Technical Grade)
CAS:4-tert-Butyl-2-chlorophenol (TBPC) is a reactive chemical that has been used as a biocide, a coproduct in the manufacture of phenolic resins, and an intermediate for insecticides. It has also been shown to be effective against human urine bacteria. TBPC reacts with zirconium to form a precipitate. The iodine and sulfate ions react with TBPC to form iodides and sulfates. Dialkyl phosphates and chlorinations are also formed in this reaction. The chlorination reaction is monitored by the presence of chlorine gas. Carbamate formation is monitored by the disappearance of the carbamate peak in the IR spectrum. Recoveries are determined by comparing the mass balance of each step in the process to determine how much material was actually recovered from each step in the process.Formula:C10H13ClOPurity:Min. 95%Molecular weight:184.66 g/mol






