CymitQuimica logo

CAS 98006-90-7

:

2-bromo-5-methyl-pyrazine

Description:
2-Bromo-5-methyl-pyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a bromine atom at the second position and a methyl group at the fifth position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in the synthesis of pharmaceuticals and agrochemicals, as well as in flavor and fragrance chemistry due to its distinctive odor profile. The compound is soluble in organic solvents, and its reactivity can be influenced by the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and storage conditions are essential to mitigate any hazards associated with its use.
Formula:C5H5BrN2
InChI:InChI=1/C5H5BrN2/c1-4-2-8-5(6)3-7-4/h2-3H,1H3
InChI key:OBZRGWKVWAXNKZ-UHFFFAOYSA-N
SMILES:Cc1cnc(cn1)Br
Synonyms:
  • 2-Bromo-5-Methylpyrazine
  • Pyrazine, 2-Bromo-5-Methyl-
Found 6 products.