CymitQuimica logo

CAS 98011-28-0

:

(4R)-6-amino-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide

Description:
(4R)-6-amino-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide, with the CAS number 98011-28-0, is a chemical compound characterized by its tetrahydropyrimidine core structure, which features a thioxo group and an amide functional group. This compound exhibits a chiral center at the 4-position, contributing to its stereochemical properties. The presence of the phenyl group enhances its potential for interactions in biological systems, making it of interest in medicinal chemistry. The thioxo group may impart unique reactivity and stability characteristics, influencing its behavior in various chemical environments. Additionally, the amine and carboxamide functionalities suggest potential for hydrogen bonding, which can affect solubility and reactivity. Overall, this compound's structural features may contribute to its biological activity, making it a candidate for further investigation in pharmaceutical applications. Its specific properties, such as solubility, melting point, and reactivity, would need to be determined through experimental studies to fully understand its potential uses.
Formula:C11H12N4OS
InChI:InChI=1/C11H12N4OS/c12-9-7(10(13)16)8(14-11(17)15-9)6-4-2-1-3-5-6/h1-5,8H,12H2,(H2,13,16)(H2,14,15,17)/t8-/m1/s1
SMILES:c1ccc(cc1)[C@@H]1C(=C(N)NC(=N1)S)C(=N)O
Found 1 products.