CymitQuimica logo

CAS 98021-98-8

:

Carbonochloridic acid, tetrahydro-3-furanyl ester

Description:
Carbonochloridic acid, tetrahydro-3-furanyl ester, identified by the CAS number 98021-98-8, is an organic compound characterized by its ester functional group derived from carbonochloridic acid and tetrahydro-3-furanol. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a distinctive odor. It is likely to be soluble in organic solvents while having limited solubility in water due to the hydrophobic nature of the furan ring. The presence of the chloridic acid moiety suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the tetrahydrofuran structure contributes to its stability and may influence its boiling point and volatility. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks through inhalation or skin contact. Overall, its unique structure and functional groups make it of interest in various chemical applications, including synthesis and possibly in the development of pharmaceuticals or agrochemicals.
Formula:C5H7ClO3
InChI:InChI=1S/C5H7ClO3/c6-5(7)9-4-1-2-8-3-4/h4H,1-3H2
InChI key:BULSKJQNVXVGHX-UHFFFAOYSA-N
SMILES:C1COCC1OC(=O)Cl
Found 4 products.